C13H14F3NO2 — CID 116603183
[4-(aminomethyl)oxan-4-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 116603183) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is [4-(aminomethyl)oxan-4-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-(aminomethyl)oxan-4-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 116603183 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | [4-(aminomethyl)oxan-4-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | NCC1(C(=O)c2ccc(F)c(F)c2F)CCOCC1 |
| InChI | InChI=1S/C13H14F3NO2/c14-9-2-1-8(10(15)11(9)16)12(18)13(7-17)3-5-19-6-4-13/h1-2H,3-7,17H2 |
| InChIKey | IFGZQZQJQSWSKK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|