C20H22F3NO5 — CID 91345671
tert-butyl 2-[[4,4-dimethyl-1,3-dioxo-6-(trifluoromethyl)naphthalene-2-carbonyl]amino]acetate (PubChem CID 91345671) has the molecular formula C20H22F3NO5 and a molecular weight of 413.39 g/mol. Its IUPAC name is tert-butyl 2-[[4,4-dimethyl-1,3-dioxo-6-(trifluoromethyl)naphthalene-2-carbonyl]amino]acetate.
| Compound Name | tert-butyl 2-[[4,4-dimethyl-1,3-dioxo-6-(trifluoromethyl)naphthalene-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 91345671 |
| Molecular Formula | C20H22F3NO5 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | tert-butyl 2-[[4,4-dimethyl-1,3-dioxo-6-(trifluoromethyl)naphthalene-2-carbonyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)C1C(=O)c2ccc(C(F)(F)F)cc2C(C)(C)C1=O |
| InChI | InChI=1S/C20H22F3NO5/c1-18(2,3)29-13(25)9-24-17(28)14-15(26)11-7-6-10(20(21,22)23)8-12(11)19(4,5)16(14)27/h6-8,14H,9H2,1-5H3,(H,24,28) |
| InChIKey | NNGBTACRDQRAQE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|