C19H22FNO5 — CID 91327592
tert-butyl 2-[(6-fluoro-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetate (PubChem CID 91327592) has the molecular formula C19H22FNO5 and a molecular weight of 363.39 g/mol. Its IUPAC name is tert-butyl 2-[(6-fluoro-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetate.
| Compound Name | tert-butyl 2-[(6-fluoro-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 91327592 |
| Molecular Formula | C19H22FNO5 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | tert-butyl 2-[(6-fluoro-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)C1C(=O)c2ccc(F)cc2C(C)(C)C1=O |
| InChI | InChI=1S/C19H22FNO5/c1-18(2,3)26-13(22)9-21-17(25)14-15(23)11-7-6-10(20)8-12(11)19(4,5)16(14)24/h6-8,14H,9H2,1-5H3,(H,21,25) |
| InChIKey | JVZPFGXCEPZUCA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|