C28H31ClN2O5 — CID 90691648
tert-butyl 2-[(1'-benzyl-7-chloro-1,3-dioxospiro[naphthalene-4,4'-piperidine]-2-carbonyl)amino]acetate (PubChem CID 90691648) has the molecular formula C28H31ClN2O5 and a molecular weight of 511.02 g/mol. Its IUPAC name is tert-butyl 2-[(1'-benzyl-7-chloro-1,3-dioxospiro[naphthalene-4,4'-piperidine]-2-carbonyl)amino]acetate.
| Compound Name | tert-butyl 2-[(1'-benzyl-7-chloro-1,3-dioxospiro[naphthalene-4,4'-piperidine]-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 90691648 |
| Molecular Formula | C28H31ClN2O5 |
| Molecular Weight | 511.02 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | tert-butyl 2-[(1'-benzyl-7-chloro-1,3-dioxospiro[naphthalene-4,4'-piperidine]-2-carbonyl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)C1C(=O)c2cc(Cl)ccc2C2(CCN(Cc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C28H31ClN2O5/c1-27(2,3)36-22(32)16-30-26(35)23-24(33)20-15-19(29)9-10-21(20)28(25(23)34)11-13-31(14-12-28)17-18-7-5-4-6-8-18/h4-10,15,23H,11-14,16-17H2,1-3H3,(H,30,35) |
| InChIKey | RUMWXTTXWGLCHF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.02 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|