C21H24FNO6 — CID 91475069
tert-butyl 2-[(6-fluoro-1,3-dioxospiro[naphthalene-4,4'-oxane]-2-carbonyl)amino]acetate (PubChem CID 91475069) has the molecular formula C21H24FNO6 and a molecular weight of 405.42 g/mol. Its IUPAC name is tert-butyl 2-[(6-fluoro-1,3-dioxospiro[naphthalene-4,4'-oxane]-2-carbonyl)amino]acetate.
| Compound Name | tert-butyl 2-[(6-fluoro-1,3-dioxospiro[naphthalene-4,4'-oxane]-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 91475069 |
| Molecular Formula | C21H24FNO6 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | tert-butyl 2-[(6-fluoro-1,3-dioxospiro[naphthalene-4,4'-oxane]-2-carbonyl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)C1C(=O)c2ccc(F)cc2C2(CCOCC2)C1=O |
| InChI | InChI=1S/C21H24FNO6/c1-20(2,3)29-15(24)11-23-19(27)16-17(25)13-5-4-12(22)10-14(13)21(18(16)26)6-8-28-9-7-21/h4-5,10,16H,6-9,11H2,1-3H3,(H,23,27) |
| InChIKey | WWHZMQBCUGMIIJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|