C16H16ClNO5 — CID 91198029
2-[(6-chloro-4-ethyl-4-methyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetic acid (PubChem CID 91198029) has the molecular formula C16H16ClNO5 and a molecular weight of 337.76 g/mol. Its IUPAC name is 2-[(6-chloro-4-ethyl-4-methyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetic acid.
| Compound Name | 2-[(6-chloro-4-ethyl-4-methyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 91198029 |
| Molecular Formula | C16H16ClNO5 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-[(6-chloro-4-ethyl-4-methyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetic acid |
| SMILES | CCC1(C)C(=O)C(C(=O)NCC(=O)O)C(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H16ClNO5/c1-3-16(2)10-6-8(17)4-5-9(10)13(21)12(14(16)22)15(23)18-7-11(19)20/h4-6,12H,3,7H2,1-2H3,(H,18,23)(H,19,20) |
| InChIKey | NZCONJRSUPXHSC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|