C17H11ClF3N3O5S — CID 46204286
2-[[6-chloro-8-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2,4-dioxothiochromene-3-carbonyl]amino]acetic acid (PubChem CID 46204286) has the molecular formula C17H11ClF3N3O5S and a molecular weight of 461.81 g/mol. Its IUPAC name is 2-[[6-chloro-8-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2,4-dioxothiochromene-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[6-chloro-8-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2,4-dioxothiochromene-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 46204286 |
| Molecular Formula | C17H11ClF3N3O5S |
| Molecular Weight | 461.81 g/mol |
| Exact Mass | 461.01 |
| IUPAC Name | 2-[[6-chloro-8-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2,4-dioxothiochromene-3-carbonyl]amino]acetic acid |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1cc(Cl)cc2c1SC(=O)C(C(=O)NCC(=O)O)C2=O |
| InChI | InChI=1S/C17H11ClF3N3O5S/c1-24-9(4-10(23-24)17(19,20)21)7-2-6(18)3-8-13(27)12(16(29)30-14(7)8)15(28)22-5-11(25)26/h2-4,12H,5H2,1H3,(H,22,28)(H,25,26) |
| InChIKey | SXHLQAORRKUWOJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.81 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|