C17H11ClF3N3O6 — CID 87654509
(2S)-2-[6-chloro-4-hydroxy-8-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-oxochromen-3-yl]-2-formamidoacetic acid (PubChem CID 87654509) has the molecular formula C17H11ClF3N3O6 and a molecular weight of 445.74 g/mol. Its IUPAC name is (2S)-2-[6-chloro-4-hydroxy-8-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-oxochromen-3-yl]-2-formamidoacetic acid.
| Compound Name | (2S)-2-[6-chloro-4-hydroxy-8-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-oxochromen-3-yl]-2-formamidoacetic acid |
|---|---|
| PubChem CID | 87654509 |
| Molecular Formula | C17H11ClF3N3O6 |
| Molecular Weight | 445.74 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | (2S)-2-[6-chloro-4-hydroxy-8-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-oxochromen-3-yl]-2-formamidoacetic acid |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1cc(Cl)cc2c(O)c([C@H](NC=O)C(=O)O)c(=O)oc12 |
| InChI | InChI=1S/C17H11ClF3N3O6/c1-24-9(4-10(23-24)17(19,20)21)7-2-6(18)3-8-13(26)11(16(29)30-14(7)8)12(15(27)28)22-5-25/h2-5,12,26H,1H3,(H,22,25)(H,27,28)/t12-/m0/s1 |
| InChIKey | QZCLNLDDHFUTJS-LBPRGKRZSA-N |
| XLogP | 2.44 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|