C18H15F3N2O4 — CID 168598744
2,2-dimethyl-5-[[2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168598744) has the molecular formula C18H15F3N2O4 and a molecular weight of 380.32 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168598744 |
| Molecular Formula | C18H15F3N2O4 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2,2-dimethyl-5-[[2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1ccccc1C=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C18H15F3N2O4/c1-17(2)26-15(24)12(16(25)27-17)8-10-6-4-5-7-11(10)13-9-14(18(19,20)21)22-23(13)3/h4-9H,1-3H3 |
| InChIKey | PONMFYDMTWPQOB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|