C16H14F3N5S — CID 168619411
4-methyl-N-[[2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168619411) has the molecular formula C16H14F3N5S and a molecular weight of 365.38 g/mol. Its IUPAC name is 4-methyl-N-[[2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-[[2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168619411 |
| Molecular Formula | C16H14F3N5S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4-methyl-N-[[2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2ccccc2-c2cc(C(F)(F)F)nn2C)n1 |
| InChI | InChI=1S/C16H14F3N5S/c1-10-9-25-15(21-10)22-20-8-11-5-3-4-6-12(11)13-7-14(16(17,18)19)23-24(13)2/h3-9H,1-2H3,(H,21,22) |
| InChIKey | CMGRCTKFLRVVSX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|