C20H20ClN3O6 — CID 123207171
2-[[1-[[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl]-6,6-dimethyl-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid (PubChem CID 123207171) has the molecular formula C20H20ClN3O6 and a molecular weight of 433.85 g/mol. Its IUPAC name is 2-[[1-[[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl]-6,6-dimethyl-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-[[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl]-6,6-dimethyl-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 123207171 |
| Molecular Formula | C20H20ClN3O6 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-[[1-[[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl]-6,6-dimethyl-2,4-dioxopiperidine-3-carbonyl]amino]acetic acid |
| SMILES | CC1(C)CC(=O)C(C(=O)NCC(=O)O)C(=O)N1Cc1cc(-c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C20H20ClN3O6/c1-20(2)8-14(25)17(18(28)22-9-16(26)27)19(29)24(20)10-13-7-15(30-23-13)11-3-5-12(21)6-4-11/h3-7,17H,8-10H2,1-2H3,(H,22,28)(H,26,27) |
| InChIKey | KOFBBMTZAKWWLZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|