C25H27N3O5 — CID 123912353
2-[[2,4-dioxo-1-[(4-phenylphenyl)methyl]-1,9-diazaspiro[5.5]undecane-3-carbonyl]amino]acetic acid (PubChem CID 123912353) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[[2,4-dioxo-1-[(4-phenylphenyl)methyl]-1,9-diazaspiro[5.5]undecane-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[2,4-dioxo-1-[(4-phenylphenyl)methyl]-1,9-diazaspiro[5.5]undecane-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 123912353 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-[[2,4-dioxo-1-[(4-phenylphenyl)methyl]-1,9-diazaspiro[5.5]undecane-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)CC2(CCNCC2)N(Cc2ccc(-c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C25H27N3O5/c29-20-14-25(10-12-26-13-11-25)28(24(33)22(20)23(32)27-15-21(30)31)16-17-6-8-19(9-7-17)18-4-2-1-3-5-18/h1-9,22,26H,10-16H2,(H,27,32)(H,30,31) |
| InChIKey | MGKSCPCDNDOPRC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|