C32H32N2O5 — CID 123243362
ethyl 9-benzoyl-2,4-dioxo-1-[(4-phenylphenyl)methyl]-1,9-diazaspiro[5.5]undecane-3-carboxylate (PubChem CID 123243362) has the molecular formula C32H32N2O5 and a molecular weight of 524.62 g/mol. Its IUPAC name is ethyl 9-benzoyl-2,4-dioxo-1-[(4-phenylphenyl)methyl]-1,9-diazaspiro[5.5]undecane-3-carboxylate.
| Compound Name | ethyl 9-benzoyl-2,4-dioxo-1-[(4-phenylphenyl)methyl]-1,9-diazaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 123243362 |
| Molecular Formula | C32H32N2O5 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | ethyl 9-benzoyl-2,4-dioxo-1-[(4-phenylphenyl)methyl]-1,9-diazaspiro[5.5]undecane-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)CC2(CCN(C(=O)c3ccccc3)CC2)N(Cc2ccc(-c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C32H32N2O5/c1-2-39-31(38)28-27(35)21-32(17-19-33(20-18-32)29(36)26-11-7-4-8-12-26)34(30(28)37)22-23-13-15-25(16-14-23)24-9-5-3-6-10-24/h3-16,28H,2,17-22H2,1H3 |
| InChIKey | SRYXEVNJJKCDPR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|