C16H12ClNO5 — CID 91060853
4-[(4R)-7-chloro-4-isocyano-4-methyl-1,3-dioxonaphthalen-2-yl]-4-oxobutanoic acid (PubChem CID 91060853) has the molecular formula C16H12ClNO5 and a molecular weight of 333.73 g/mol. Its IUPAC name is 4-[(4R)-7-chloro-4-isocyano-4-methyl-1,3-dioxonaphthalen-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[(4R)-7-chloro-4-isocyano-4-methyl-1,3-dioxonaphthalen-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91060853 |
| Molecular Formula | C16H12ClNO5 |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 4-[(4R)-7-chloro-4-isocyano-4-methyl-1,3-dioxonaphthalen-2-yl]-4-oxobutanoic acid |
| SMILES | [C-]#[N+][C@@]1(C)C(=O)C(C(=O)CCC(=O)O)C(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H12ClNO5/c1-16(18-2)10-4-3-8(17)7-9(10)14(22)13(15(16)23)11(19)5-6-12(20)21/h3-4,7,13H,5-6H2,1H3,(H,20,21)/t13?,16-/m1/s1 |
| InChIKey | IZXJXEPFRFYBLK-FQNRMIAFSA-N |
| XLogP | 2.29 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|