C26H28Cl2O9 — CID 157204289
4-(4-chlorophenoxy)butanoic acid;5-[4-(4-chlorophenoxy)butanoyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 157204289) has the molecular formula C26H28Cl2O9 and a molecular weight of 555.41 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)butanoic acid;5-[4-(4-chlorophenoxy)butanoyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 4-(4-chlorophenoxy)butanoic acid;5-[4-(4-chlorophenoxy)butanoyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 157204289 |
| Molecular Formula | C26H28Cl2O9 |
| Molecular Weight | 555.41 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | 4-(4-chlorophenoxy)butanoic acid;5-[4-(4-chlorophenoxy)butanoyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C(=O)CCCOc2ccc(Cl)cc2)C(=O)O1.O=C(O)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClO6.C10H11ClO3/c1-16(2)22-14(19)13(15(20)23-16)12(18)4-3-9-21-11-7-5-10(17)6-8-11;11-8-3-5-9(6-4-8)14-7-1-2-10(12)13/h5-8,13H,3-4,9H2,1-2H3;3-6H,1-2,7H2,(H,12,13) |
| InChIKey | ARDZGDBGLXEHCH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|