C12H11ClO3 — CID 170009555
(2S,3R)-7-chloro-3-hydroxy-2,3-dimethyl-2H-naphthalene-1,4-dione (PubChem CID 170009555) has the molecular formula C12H11ClO3 and a molecular weight of 238.67 g/mol. Its IUPAC name is (2S,3R)-7-chloro-3-hydroxy-2,3-dimethyl-2H-naphthalene-1,4-dione.
| Compound Name | (2S,3R)-7-chloro-3-hydroxy-2,3-dimethyl-2H-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 170009555 |
| Molecular Formula | C12H11ClO3 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | (2S,3R)-7-chloro-3-hydroxy-2,3-dimethyl-2H-naphthalene-1,4-dione |
| SMILES | C[C@@H]1C(=O)c2cc(Cl)ccc2C(=O)[C@]1(C)O |
| InChI | InChI=1S/C12H11ClO3/c1-6-10(14)9-5-7(13)3-4-8(9)11(15)12(6,2)16/h3-6,16H,1-2H3/t6-,12-/m1/s1 |
| InChIKey | WIDYMCMOLXTCBL-SREIQFSDSA-N |
| XLogP | 2.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|