C16H14F3NO5 — CID 91372545
2-[[4,4-dimethyl-1,3-dioxo-8-(trifluoromethyl)naphthalene-2-carbonyl]amino]acetic acid (PubChem CID 91372545) has the molecular formula C16H14F3NO5 and a molecular weight of 357.28 g/mol. Its IUPAC name is 2-[[4,4-dimethyl-1,3-dioxo-8-(trifluoromethyl)naphthalene-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[4,4-dimethyl-1,3-dioxo-8-(trifluoromethyl)naphthalene-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 91372545 |
| Molecular Formula | C16H14F3NO5 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[[4,4-dimethyl-1,3-dioxo-8-(trifluoromethyl)naphthalene-2-carbonyl]amino]acetic acid |
| SMILES | CC1(C)C(=O)C(C(=O)NCC(=O)O)C(=O)c2c(C(F)(F)F)cccc21 |
| InChI | InChI=1S/C16H14F3NO5/c1-15(2)7-4-3-5-8(16(17,18)19)10(7)12(23)11(13(15)24)14(25)20-6-9(21)22/h3-5,11H,6H2,1-2H3,(H,20,25)(H,21,22) |
| InChIKey | APNVYGUIESIRLM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|