C19H12F3NO5S — CID 46206882
2-[[2,4-dioxo-6-[2-(trifluoromethyl)phenyl]thiochromene-3-carbonyl]amino]acetic acid (PubChem CID 46206882) has the molecular formula C19H12F3NO5S and a molecular weight of 423.37 g/mol. Its IUPAC name is 2-[[2,4-dioxo-6-[2-(trifluoromethyl)phenyl]thiochromene-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[2,4-dioxo-6-[2-(trifluoromethyl)phenyl]thiochromene-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 46206882 |
| Molecular Formula | C19H12F3NO5S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 2-[[2,4-dioxo-6-[2-(trifluoromethyl)phenyl]thiochromene-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)Sc2ccc(-c3ccccc3C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C19H12F3NO5S/c20-19(21,22)12-4-2-1-3-10(12)9-5-6-13-11(7-9)16(26)15(18(28)29-13)17(27)23-8-14(24)25/h1-7,15H,8H2,(H,23,27)(H,24,25) |
| InChIKey | HLWWCIZEOFJTRC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|