C18H12ClNO5 — CID 90834960
2-[[5-(2-chlorophenyl)-1,3-dioxoindene-2-carbonyl]amino]acetic acid (PubChem CID 90834960) has the molecular formula C18H12ClNO5 and a molecular weight of 357.75 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-1,3-dioxoindene-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[5-(2-chlorophenyl)-1,3-dioxoindene-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 90834960 |
| Molecular Formula | C18H12ClNO5 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-1,3-dioxoindene-2-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)c2ccc(-c3ccccc3Cl)cc2C1=O |
| InChI | InChI=1S/C18H12ClNO5/c19-13-4-2-1-3-10(13)9-5-6-11-12(7-9)17(24)15(16(11)23)18(25)20-8-14(21)22/h1-7,15H,8H2,(H,20,25)(H,21,22) |
| InChIKey | VISREIVEBSLFLO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|