C12H8FNO5 — CID 91166350
2-[(4-fluoro-1,3-dioxoindene-2-carbonyl)amino]acetic acid (PubChem CID 91166350) has the molecular formula C12H8FNO5 and a molecular weight of 265.20 g/mol. Its IUPAC name is 2-[(4-fluoro-1,3-dioxoindene-2-carbonyl)amino]acetic acid.
| Compound Name | 2-[(4-fluoro-1,3-dioxoindene-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 91166350 |
| Molecular Formula | C12H8FNO5 |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2-[(4-fluoro-1,3-dioxoindene-2-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)c2cccc(F)c2C1=O |
| InChI | InChI=1S/C12H8FNO5/c13-6-3-1-2-5-8(6)11(18)9(10(5)17)12(19)14-4-7(15)16/h1-3,9H,4H2,(H,14,19)(H,15,16) |
| InChIKey | IVGVWMUXZFHKFI-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|