C15H14FNO5 — CID 90820254
2-[(5-fluoro-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetic acid (PubChem CID 90820254) has the molecular formula C15H14FNO5 and a molecular weight of 307.28 g/mol. Its IUPAC name is 2-[(5-fluoro-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetic acid.
| Compound Name | 2-[(5-fluoro-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 90820254 |
| Molecular Formula | C15H14FNO5 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-[(5-fluoro-4,4-dimethyl-1,3-dioxonaphthalene-2-carbonyl)amino]acetic acid |
| SMILES | CC1(C)C(=O)C(C(=O)NCC(=O)O)C(=O)c2cccc(F)c21 |
| InChI | InChI=1S/C15H14FNO5/c1-15(2)11-7(4-3-5-8(11)16)12(20)10(13(15)21)14(22)17-6-9(18)19/h3-5,10H,6H2,1-2H3,(H,17,22)(H,18,19) |
| InChIKey | YSDQALSNQMYGPY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|