C17H12N2O5 — CID 91406065
2-[(1,3-dioxo-4-pyridin-3-ylindene-2-carbonyl)amino]acetic acid (PubChem CID 91406065) has the molecular formula C17H12N2O5 and a molecular weight of 324.29 g/mol. Its IUPAC name is 2-[(1,3-dioxo-4-pyridin-3-ylindene-2-carbonyl)amino]acetic acid.
| Compound Name | 2-[(1,3-dioxo-4-pyridin-3-ylindene-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 91406065 |
| Molecular Formula | C17H12N2O5 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-[(1,3-dioxo-4-pyridin-3-ylindene-2-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)c2cccc(-c3cccnc3)c2C1=O |
| InChI | InChI=1S/C17H12N2O5/c20-12(21)8-19-17(24)14-15(22)11-5-1-4-10(13(11)16(14)23)9-3-2-6-18-7-9/h1-7,14H,8H2,(H,19,24)(H,20,21) |
| InChIKey | WJAFQVSRLWWQSA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|