C17H13ClO3 — CID 167826845
2-[6-(2-chlorophenyl)-3-oxo-1,2-dihydroinden-2-yl]acetic acid (PubChem CID 167826845) has the molecular formula C17H13ClO3 and a molecular weight of 300.74 g/mol. Its IUPAC name is 2-[6-(2-chlorophenyl)-3-oxo-1,2-dihydroinden-2-yl]acetic acid.
| Compound Name | 2-[6-(2-chlorophenyl)-3-oxo-1,2-dihydroinden-2-yl]acetic acid |
|---|---|
| PubChem CID | 167826845 |
| Molecular Formula | C17H13ClO3 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[6-(2-chlorophenyl)-3-oxo-1,2-dihydroinden-2-yl]acetic acid |
| SMILES | O=C(O)CC1Cc2cc(-c3ccccc3Cl)ccc2C1=O |
| InChI | InChI=1S/C17H13ClO3/c18-15-4-2-1-3-13(15)10-5-6-14-11(7-10)8-12(17(14)21)9-16(19)20/h1-7,12H,8-9H2,(H,19,20) |
| InChIKey | BXTZVUCSEMNLGD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |