C15H17NO4 — CID 139381129
tert-butyl 2-[3-(4-hydroxyphenyl)prop-2-ynoylamino]acetate (PubChem CID 139381129) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is tert-butyl 2-[3-(4-hydroxyphenyl)prop-2-ynoylamino]acetate.
| Compound Name | tert-butyl 2-[3-(4-hydroxyphenyl)prop-2-ynoylamino]acetate |
|---|---|
| PubChem CID | 139381129 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | tert-butyl 2-[3-(4-hydroxyphenyl)prop-2-ynoylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)C#Cc1ccc(O)cc1 |
| InChI | InChI=1S/C15H17NO4/c1-15(2,3)20-14(19)10-16-13(18)9-6-11-4-7-12(17)8-5-11/h4-5,7-8,17H,10H2,1-3H3,(H,16,18) |
| InChIKey | NVAQQUXZLIQCBX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|