C11H14F2O2S — CID 116841298
1-(1,1-difluoropropyl)-4-ethylsulfonylbenzene (PubChem CID 116841298) has the molecular formula C11H14F2O2S and a molecular weight of 248.29 g/mol. Its IUPAC name is 1-(1,1-difluoropropyl)-4-ethylsulfonylbenzene.
| Compound Name | 1-(1,1-difluoropropyl)-4-ethylsulfonylbenzene |
|---|---|
| PubChem CID | 116841298 |
| Molecular Formula | C11H14F2O2S |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1-(1,1-difluoropropyl)-4-ethylsulfonylbenzene |
| SMILES | CCC(F)(F)c1ccc(S(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C11H14F2O2S/c1-3-11(12,13)9-5-7-10(8-6-9)16(14,15)4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | KEYAYOHRGDNGJV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |