C16H12F6O5S2 — CID 55908333
[3,5-bis(trifluoromethyl)phenyl] 4-ethylsulfonylbenzenesulfonate (PubChem CID 55908333) has the molecular formula C16H12F6O5S2 and a molecular weight of 462.39 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] 4-ethylsulfonylbenzenesulfonate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] 4-ethylsulfonylbenzenesulfonate |
|---|---|
| PubChem CID | 55908333 |
| Molecular Formula | C16H12F6O5S2 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] 4-ethylsulfonylbenzenesulfonate |
| SMILES | CCS(=O)(=O)c1ccc(S(=O)(=O)Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H12F6O5S2/c1-2-28(23,24)13-3-5-14(6-4-13)29(25,26)27-12-8-10(15(17,18)19)7-11(9-12)16(20,21)22/h3-9H,2H2,1H3 |
| InChIKey | KECYJROLSWYLTD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|