C21H19F2NO5 — CID 22179179
6-[8-(difluoromethoxy)quinoline-5-carbonyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 22179179) has the molecular formula C21H19F2NO5 and a molecular weight of 403.38 g/mol. Its IUPAC name is 6-[8-(difluoromethoxy)quinoline-5-carbonyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-[8-(difluoromethoxy)quinoline-5-carbonyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 22179179 |
| Molecular Formula | C21H19F2NO5 |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 6-[8-(difluoromethoxy)quinoline-5-carbonyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | CC1(C)C(=O)C(C(=O)c2ccc(OC(F)F)c3ncccc23)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C21H19F2NO5/c1-20(2)16(26)13(17(27)21(3,4)18(20)28)15(25)11-7-8-12(29-19(22)23)14-10(11)6-5-9-24-14/h5-9,13,19H,1-4H3 |
| InChIKey | BLTDWLYYKRRALG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|