C17H13F3N2O3 — CID 141247172
5-methyl-2-[2-(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione (PubChem CID 141247172) has the molecular formula C17H13F3N2O3 and a molecular weight of 350.30 g/mol. Its IUPAC name is 5-methyl-2-[2-(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione.
| Compound Name | 5-methyl-2-[2-(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 141247172 |
| Molecular Formula | C17H13F3N2O3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 5-methyl-2-[2-(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione |
| SMILES | CC1CC(=O)C(C(=O)c2cc3cccnc3nc2C(F)(F)F)C(=O)C1 |
| InChI | InChI=1S/C17H13F3N2O3/c1-8-5-11(23)13(12(24)6-8)14(25)10-7-9-3-2-4-21-16(9)22-15(10)17(18,19)20/h2-4,7-8,13H,5-6H2,1H3 |
| InChIKey | HJLPVLSVDQREME-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|