C18H13F3N2O3 — CID 141247186
7-[2-(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]spiro[2.5]octane-6,8-dione (PubChem CID 141247186) has the molecular formula C18H13F3N2O3 and a molecular weight of 362.31 g/mol. Its IUPAC name is 7-[2-(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]spiro[2.5]octane-6,8-dione.
| Compound Name | 7-[2-(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]spiro[2.5]octane-6,8-dione |
|---|---|
| PubChem CID | 141247186 |
| Molecular Formula | C18H13F3N2O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 7-[2-(trifluoromethyl)-1,8-naphthyridine-3-carbonyl]spiro[2.5]octane-6,8-dione |
| SMILES | O=C1CCC2(CC2)C(=O)C1C(=O)c1cc2cccnc2nc1C(F)(F)F |
| InChI | InChI=1S/C18H13F3N2O3/c19-18(20,21)14-10(8-9-2-1-7-22-16(9)23-14)13(25)12-11(24)3-4-17(5-6-17)15(12)26/h1-2,7-8,12H,3-6H2 |
| InChIKey | SXGQIZGJPWCHFS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|