C16H14F3NO3 — CID 54138062
4-methyl-2-[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]cyclohept-4-ene-1,3-dione (PubChem CID 54138062) has the molecular formula C16H14F3NO3 and a molecular weight of 325.29 g/mol. Its IUPAC name is 4-methyl-2-[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]cyclohept-4-ene-1,3-dione.
| Compound Name | 4-methyl-2-[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]cyclohept-4-ene-1,3-dione |
|---|---|
| PubChem CID | 54138062 |
| Molecular Formula | C16H14F3NO3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 4-methyl-2-[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]cyclohept-4-ene-1,3-dione |
| SMILES | CC1=CCCC(=O)C(C(=O)c2ccc(C(F)(F)F)nc2C)C1=O |
| InChI | InChI=1S/C16H14F3NO3/c1-8-4-3-5-11(21)13(14(8)22)15(23)10-6-7-12(16(17,18)19)20-9(10)2/h4,6-7,13H,3,5H2,1-2H3 |
| InChIKey | NZCYGMQMOQXJPW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|