C14H15F3N2O3 — CID 119137791
1-[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]piperidine-2-carboxylic acid (PubChem CID 119137791) has the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is 1-[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119137791 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-[2-methyl-6-(trifluoromethyl)pyridine-3-carbonyl]piperidine-2-carboxylic acid |
| SMILES | Cc1nc(C(F)(F)F)ccc1C(=O)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C14H15F3N2O3/c1-8-9(5-6-11(18-8)14(15,16)17)12(20)19-7-3-2-4-10(19)13(21)22/h5-6,10H,2-4,7H2,1H3,(H,21,22) |
| InChIKey | SYGUXRSYJIFEJY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |