C14H17F3N2O — CID 134005087
(3-methylpiperidin-1-yl)-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 134005087) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is (3-methylpiperidin-1-yl)-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | (3-methylpiperidin-1-yl)-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 134005087 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (3-methylpiperidin-1-yl)-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | Cc1nc(C(F)(F)F)ccc1C(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C14H17F3N2O/c1-9-4-3-7-19(8-9)13(20)11-5-6-12(14(15,16)17)18-10(11)2/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | COCHYYKQOLUBLK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |