C14H18F3N3O — CID 134004996
(4-ethylpiperazin-1-yl)-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 134004996) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 134004996 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | CCN1CCN(C(=O)c2ccc(C(F)(F)F)nc2C)CC1 |
| InChI | InChI=1S/C14H18F3N3O/c1-3-19-6-8-20(9-7-19)13(21)11-4-5-12(14(15,16)17)18-10(11)2/h4-5H,3,6-9H2,1-2H3 |
| InChIKey | PRYWAKAIKYLGBQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |