C19H17F3N2O4 — CID 66602414
2-[2-[ethoxy(difluoro)methyl]-6-fluoro-7-methyl-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione (PubChem CID 66602414) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is 2-[2-[ethoxy(difluoro)methyl]-6-fluoro-7-methyl-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione.
| Compound Name | 2-[2-[ethoxy(difluoro)methyl]-6-fluoro-7-methyl-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 66602414 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-[2-[ethoxy(difluoro)methyl]-6-fluoro-7-methyl-1,8-naphthyridine-3-carbonyl]cyclohexane-1,3-dione |
| SMILES | CCOC(F)(F)c1nc2nc(C)c(F)cc2cc1C(=O)C1C(=O)CCCC1=O |
| InChI | InChI=1S/C19H17F3N2O4/c1-3-28-19(21,22)17-11(16(27)15-13(25)5-4-6-14(15)26)7-10-8-12(20)9(2)23-18(10)24-17/h7-8,15H,3-6H2,1-2H3 |
| InChIKey | MBASJMDVUCOMSD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|