C14H13F3N2O4 — CID 66602515
2-[difluoro(2-methoxyethoxy)methyl]-6-fluoro-7-methyl-1,8-naphthyridine-3-carboxylic acid (PubChem CID 66602515) has the molecular formula C14H13F3N2O4 and a molecular weight of 330.26 g/mol. Its IUPAC name is 2-[difluoro(2-methoxyethoxy)methyl]-6-fluoro-7-methyl-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 2-[difluoro(2-methoxyethoxy)methyl]-6-fluoro-7-methyl-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 66602515 |
| Molecular Formula | C14H13F3N2O4 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[difluoro(2-methoxyethoxy)methyl]-6-fluoro-7-methyl-1,8-naphthyridine-3-carboxylic acid |
| SMILES | COCCOC(F)(F)c1nc2nc(C)c(F)cc2cc1C(=O)O |
| InChI | InChI=1S/C14H13F3N2O4/c1-7-10(15)6-8-5-9(13(20)21)11(19-12(8)18-7)14(16,17)23-4-3-22-2/h5-6H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | CHZQXJYLZKNNIT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|