C15H12BrNO3S — CID 91362234
2-(2-bromo-4-methyl-1,3-benzothiazole-5-carbonyl)cyclohexane-1,3-dione (PubChem CID 91362234) has the molecular formula C15H12BrNO3S and a molecular weight of 366.24 g/mol. Its IUPAC name is 2-(2-bromo-4-methyl-1,3-benzothiazole-5-carbonyl)cyclohexane-1,3-dione.
| Compound Name | 2-(2-bromo-4-methyl-1,3-benzothiazole-5-carbonyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 91362234 |
| Molecular Formula | C15H12BrNO3S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | 2-(2-bromo-4-methyl-1,3-benzothiazole-5-carbonyl)cyclohexane-1,3-dione |
| SMILES | Cc1c(C(=O)C2C(=O)CCCC2=O)ccc2sc(Br)nc12 |
| InChI | InChI=1S/C15H12BrNO3S/c1-7-8(5-6-11-13(7)17-15(16)21-11)14(20)12-9(18)3-2-4-10(12)19/h5-6,12H,2-4H2,1H3 |
| InChIKey | YZMCMPFUBLGISA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|