C16H15NO3S2 — CID 21133782
2-[hydroxy-(4-methyl-2-methylsulfanyl-1,3-benzothiazol-5-yl)methylidene]cyclohexane-1,3-dione (PubChem CID 21133782) has the molecular formula C16H15NO3S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-[hydroxy-(4-methyl-2-methylsulfanyl-1,3-benzothiazol-5-yl)methylidene]cyclohexane-1,3-dione.
| Compound Name | 2-[hydroxy-(4-methyl-2-methylsulfanyl-1,3-benzothiazol-5-yl)methylidene]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 21133782 |
| Molecular Formula | C16H15NO3S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-[hydroxy-(4-methyl-2-methylsulfanyl-1,3-benzothiazol-5-yl)methylidene]cyclohexane-1,3-dione |
| SMILES | CSc1nc2c(C)c(C(O)=C3C(=O)CCCC3=O)ccc2s1 |
| InChI | InChI=1S/C16H15NO3S2/c1-8-9(6-7-12-14(8)17-16(21-2)22-12)15(20)13-10(18)4-3-5-11(13)19/h6-7,20H,3-5H2,1-2H3 |
| InChIKey | FMTVAZPXSOKZID-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|