C18H19F3O5S — CID 137429010
2-[hydroxy-[2-methyl-4-methylsulfinyl-3-(2,2,2-trifluoroethoxymethyl)phenyl]methylidene]cyclohexane-1,3-dione (PubChem CID 137429010) has the molecular formula C18H19F3O5S and a molecular weight of 404.41 g/mol. Its IUPAC name is 2-[hydroxy-[2-methyl-4-methylsulfinyl-3-(2,2,2-trifluoroethoxymethyl)phenyl]methylidene]cyclohexane-1,3-dione.
| Compound Name | 2-[hydroxy-[2-methyl-4-methylsulfinyl-3-(2,2,2-trifluoroethoxymethyl)phenyl]methylidene]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 137429010 |
| Molecular Formula | C18H19F3O5S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-[hydroxy-[2-methyl-4-methylsulfinyl-3-(2,2,2-trifluoroethoxymethyl)phenyl]methylidene]cyclohexane-1,3-dione |
| SMILES | Cc1c(C(O)=C2C(=O)CCCC2=O)ccc(S(C)=O)c1COCC(F)(F)F |
| InChI | InChI=1S/C18H19F3O5S/c1-10-11(17(24)16-13(22)4-3-5-14(16)23)6-7-15(27(2)25)12(10)8-26-9-18(19,20)21/h6-7,24H,3-5,8-9H2,1-2H3 |
| InChIKey | SCCBROGBTYEQID-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|