C19H22F3NO5 — CID 163959703
4-ethyl-2-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-3-pyridinyl]methylidene]cyclohexane-1,3-dione (PubChem CID 163959703) has the molecular formula C19H22F3NO5 and a molecular weight of 401.38 g/mol. Its IUPAC name is 4-ethyl-2-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-3-pyridinyl]methylidene]cyclohexane-1,3-dione.
| Compound Name | 4-ethyl-2-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-3-pyridinyl]methylidene]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 163959703 |
| Molecular Formula | C19H22F3NO5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 4-ethyl-2-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-3-pyridinyl]methylidene]cyclohexane-1,3-dione |
| SMILES | CCC1CCC(=O)C(=C(O)c2ccc(C(F)(F)F)nc2COCCOC)C1=O |
| InChI | InChI=1S/C19H22F3NO5/c1-3-11-4-6-14(24)16(17(11)25)18(26)12-5-7-15(19(20,21)22)23-13(12)10-28-9-8-27-2/h5,7,11,26H,3-4,6,8-10H2,1-2H3 |
| InChIKey | SFQIAOLRINQRFD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|