C10H11F3N2O3 — CID 89007598
N-methoxy-2-(methoxymethyl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 89007598) has the molecular formula C10H11F3N2O3 and a molecular weight of 264.20 g/mol. Its IUPAC name is N-methoxy-2-(methoxymethyl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-methoxy-2-(methoxymethyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 89007598 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-methoxy-2-(methoxymethyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | COCc1nc(C(F)(F)F)ccc1C(=O)NOC |
| InChI | InChI=1S/C10H11F3N2O3/c1-17-5-7-6(9(16)15-18-2)3-4-8(14-7)10(11,12)13/h3-4H,5H2,1-2H3,(H,15,16) |
| InChIKey | RVBDIOPEARYULS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|