C11H12F3NO4 — CID 169434452
methyl 2-(2-hydroxyethoxymethyl)-6-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 169434452) has the molecular formula C11H12F3NO4 and a molecular weight of 279.21 g/mol. Its IUPAC name is methyl 2-(2-hydroxyethoxymethyl)-6-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 2-(2-hydroxyethoxymethyl)-6-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 169434452 |
| Molecular Formula | C11H12F3NO4 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | methyl 2-(2-hydroxyethoxymethyl)-6-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(F)(F)F)nc1COCCO |
| InChI | InChI=1S/C11H12F3NO4/c1-18-10(17)7-2-3-9(11(12,13)14)15-8(7)6-19-5-4-16/h2-3,16H,4-6H2,1H3 |
| InChIKey | KPOYDYDITWLAPA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|