C17H20F3NO5 — CID 90697258
3-hydroxy-2-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)pyridine-3-carbonyl]cyclohexan-1-one (PubChem CID 90697258) has the molecular formula C17H20F3NO5 and a molecular weight of 375.34 g/mol. Its IUPAC name is 3-hydroxy-2-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)pyridine-3-carbonyl]cyclohexan-1-one.
| Compound Name | 3-hydroxy-2-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)pyridine-3-carbonyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 90697258 |
| Molecular Formula | C17H20F3NO5 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-hydroxy-2-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)pyridine-3-carbonyl]cyclohexan-1-one |
| SMILES | COCCOCc1nc(C(F)(F)F)ccc1C(=O)C1C(=O)CCCC1O |
| InChI | InChI=1S/C17H20F3NO5/c1-25-7-8-26-9-11-10(5-6-14(21-11)17(18,19)20)16(24)15-12(22)3-2-4-13(15)23/h5-6,12,15,22H,2-4,7-9H2,1H3 |
| InChIKey | SHDQVLRAJUDMOQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|