C19H20F3NO4 — CID 142795634
5-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)pyridine-3-carbonyl]bicyclo[3.2.1]oct-3-en-2-one (PubChem CID 142795634) has the molecular formula C19H20F3NO4 and a molecular weight of 383.37 g/mol. Its IUPAC name is 5-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)pyridine-3-carbonyl]bicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | 5-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)pyridine-3-carbonyl]bicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 142795634 |
| Molecular Formula | C19H20F3NO4 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 5-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)pyridine-3-carbonyl]bicyclo[3.2.1]oct-3-en-2-one |
| SMILES | COCCOCc1nc(C(F)(F)F)ccc1C(=O)C12C=CC(=O)C(CC1)C2 |
| InChI | InChI=1S/C19H20F3NO4/c1-26-8-9-27-11-14-13(2-3-16(23-14)19(20,21)22)17(25)18-6-4-12(10-18)15(24)5-7-18/h2-3,5,7,12H,4,6,8-11H2,1H3 |
| InChIKey | DBTJGFBUUAYSPB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|