C20H24F3NO5 — CID 162584326
5-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-3-pyridinyl]methylidene]-3-oxabicyclo[5.2.1]decan-6-one (PubChem CID 162584326) has the molecular formula C20H24F3NO5 and a molecular weight of 415.41 g/mol. Its IUPAC name is 5-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-3-pyridinyl]methylidene]-3-oxabicyclo[5.2.1]decan-6-one.
| Compound Name | 5-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-3-pyridinyl]methylidene]-3-oxabicyclo[5.2.1]decan-6-one |
|---|---|
| PubChem CID | 162584326 |
| Molecular Formula | C20H24F3NO5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 5-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-3-pyridinyl]methylidene]-3-oxabicyclo[5.2.1]decan-6-one |
| SMILES | COCCOCc1nc(C(F)(F)F)ccc1C(O)=C1COCC2CCC(C2)C1=O |
| InChI | InChI=1S/C20H24F3NO5/c1-27-6-7-28-11-16-14(4-5-17(24-16)20(21,22)23)19(26)15-10-29-9-12-2-3-13(8-12)18(15)25/h4-5,12-13,26H,2-3,6-11H2,1H3 |
| InChIKey | PNKLLDPJEYNMHS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|