C17H18F3NO5 — CID 20749431
2-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-3-pyridinyl]methylidene]cyclohexane-1,3-dione (PubChem CID 20749431) has the molecular formula C17H18F3NO5 and a molecular weight of 373.33 g/mol. Its IUPAC name is 2-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-3-pyridinyl]methylidene]cyclohexane-1,3-dione.
| Compound Name | 2-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-3-pyridinyl]methylidene]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 20749431 |
| Molecular Formula | C17H18F3NO5 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-[hydroxy-[2-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-3-pyridinyl]methylidene]cyclohexane-1,3-dione |
| SMILES | COCCOCc1nc(C(F)(F)F)ccc1C(O)=C1C(=O)CCCC1=O |
| InChI | InChI=1S/C17H18F3NO5/c1-25-7-8-26-9-11-10(5-6-14(21-11)17(18,19)20)16(24)15-12(22)3-2-4-13(15)23/h5-6,24H,2-4,7-9H2,1H3 |
| InChIKey | QZQHMOCGZABANH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|