C18H19F3N2O5S — CID 20749446
N-[[3-[(2,4-dioxo-3-bicyclo[3.2.1]octanylidene)-hydroxymethyl]-6-(trifluoromethyl)-2-pyridinyl]methyl]-N-methylmethanesulfonamide (PubChem CID 20749446) has the molecular formula C18H19F3N2O5S and a molecular weight of 432.42 g/mol. Its IUPAC name is N-[[3-[(2,4-dioxo-3-bicyclo[3.2.1]octanylidene)-hydroxymethyl]-6-(trifluoromethyl)-2-pyridinyl]methyl]-N-methylmethanesulfonamide.
| Compound Name | N-[[3-[(2,4-dioxo-3-bicyclo[3.2.1]octanylidene)-hydroxymethyl]-6-(trifluoromethyl)-2-pyridinyl]methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 20749446 |
| Molecular Formula | C18H19F3N2O5S |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-[[3-[(2,4-dioxo-3-bicyclo[3.2.1]octanylidene)-hydroxymethyl]-6-(trifluoromethyl)-2-pyridinyl]methyl]-N-methylmethanesulfonamide |
| SMILES | CN(Cc1nc(C(F)(F)F)ccc1C(O)=C1C(=O)C2CCC(C2)C1=O)S(C)(=O)=O |
| InChI | InChI=1S/C18H19F3N2O5S/c1-23(29(2,27)28)8-12-11(5-6-13(22-12)18(19,20)21)17(26)14-15(24)9-3-4-10(7-9)16(14)25/h5-6,9-10,26H,3-4,7-8H2,1-2H3 |
| InChIKey | PRTQTFHKHGZIJO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|