C21H22F3NO5 — CID 91385933
3-[2-(oxan-2-yloxymethyl)-6-(trifluoromethyl)pyridine-3-carbonyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 91385933) has the molecular formula C21H22F3NO5 and a molecular weight of 425.40 g/mol. Its IUPAC name is 3-[2-(oxan-2-yloxymethyl)-6-(trifluoromethyl)pyridine-3-carbonyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-[2-(oxan-2-yloxymethyl)-6-(trifluoromethyl)pyridine-3-carbonyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 91385933 |
| Molecular Formula | C21H22F3NO5 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-[2-(oxan-2-yloxymethyl)-6-(trifluoromethyl)pyridine-3-carbonyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | O=C(c1ccc(C(F)(F)F)nc1COC1CCCCO1)C1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C21H22F3NO5/c22-21(23,24)15-7-6-13(14(25-15)10-30-16-3-1-2-8-29-16)20(28)17-18(26)11-4-5-12(9-11)19(17)27/h6-7,11-12,16-17H,1-5,8-10H2 |
| InChIKey | ALUBHBQCGXFGIS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|