C24H28F3NO5 — CID 91042863
[3-(2,4-dioxobicyclo[3.2.1]octane-3-carbonyl)-6-(trifluoromethyl)-2-pyridinyl]methyl octanoate (PubChem CID 91042863) has the molecular formula C24H28F3NO5 and a molecular weight of 467.48 g/mol. Its IUPAC name is [3-(2,4-dioxobicyclo[3.2.1]octane-3-carbonyl)-6-(trifluoromethyl)-2-pyridinyl]methyl octanoate.
| Compound Name | [3-(2,4-dioxobicyclo[3.2.1]octane-3-carbonyl)-6-(trifluoromethyl)-2-pyridinyl]methyl octanoate |
|---|---|
| PubChem CID | 91042863 |
| Molecular Formula | C24H28F3NO5 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | [3-(2,4-dioxobicyclo[3.2.1]octane-3-carbonyl)-6-(trifluoromethyl)-2-pyridinyl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OCc1nc(C(F)(F)F)ccc1C(=O)C1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C24H28F3NO5/c1-2-3-4-5-6-7-19(29)33-13-17-16(10-11-18(28-17)24(25,26)27)23(32)20-21(30)14-8-9-15(12-14)22(20)31/h10-11,14-15,20H,2-9,12-13H2,1H3 |
| InChIKey | KPOIKEPVNWCPMP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|