C26H28F3NO6 — CID 91539032
4-hydroxy-3-[2-[2-(phenylmethoxymethoxy)ethoxymethyl]-6-(trifluoromethyl)pyridine-3-carbonyl]bicyclo[3.2.1]octan-2-one (PubChem CID 91539032) has the molecular formula C26H28F3NO6 and a molecular weight of 507.51 g/mol. Its IUPAC name is 4-hydroxy-3-[2-[2-(phenylmethoxymethoxy)ethoxymethyl]-6-(trifluoromethyl)pyridine-3-carbonyl]bicyclo[3.2.1]octan-2-one.
| Compound Name | 4-hydroxy-3-[2-[2-(phenylmethoxymethoxy)ethoxymethyl]-6-(trifluoromethyl)pyridine-3-carbonyl]bicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 91539032 |
| Molecular Formula | C26H28F3NO6 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 4-hydroxy-3-[2-[2-(phenylmethoxymethoxy)ethoxymethyl]-6-(trifluoromethyl)pyridine-3-carbonyl]bicyclo[3.2.1]octan-2-one |
| SMILES | O=C(c1ccc(C(F)(F)F)nc1COCCOCOCc1ccccc1)C1C(=O)C2CCC(C2)C1O |
| InChI | InChI=1S/C26H28F3NO6/c27-26(28,29)21-9-8-19(25(33)22-23(31)17-6-7-18(12-17)24(22)32)20(30-21)14-34-10-11-35-15-36-13-16-4-2-1-3-5-16/h1-5,8-9,17-18,22-23,31H,6-7,10-15H2 |
| InChIKey | JTMRYYZINFUPOO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|