C27H27F3O6 — CID 91528242
3-[2-[2-(phenylmethoxymethoxy)ethoxymethyl]-4-(trifluoromethyl)benzoyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 91528242) has the molecular formula C27H27F3O6 and a molecular weight of 504.50 g/mol. Its IUPAC name is 3-[2-[2-(phenylmethoxymethoxy)ethoxymethyl]-4-(trifluoromethyl)benzoyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-[2-[2-(phenylmethoxymethoxy)ethoxymethyl]-4-(trifluoromethyl)benzoyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 91528242 |
| Molecular Formula | C27H27F3O6 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 3-[2-[2-(phenylmethoxymethoxy)ethoxymethyl]-4-(trifluoromethyl)benzoyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1COCCOCOCc1ccccc1)C1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C27H27F3O6/c28-27(29,30)21-8-9-22(26(33)23-24(31)18-6-7-19(12-18)25(23)32)20(13-21)15-34-10-11-35-16-36-14-17-4-2-1-3-5-17/h1-5,8-9,13,18-19,23H,6-7,10-12,14-16H2 |
| InChIKey | MWMBSOCWKFERFQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|